C17H13Cl2N3S — CID 15651065
8-chloro-1-(chloromethyl)-5-phenyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzothiazepine (PubChem CID 15651065) has the molecular formula C17H13Cl2N3S and a molecular weight of 362.29 g/mol. Its IUPAC name is 8-chloro-1-(chloromethyl)-5-phenyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzothiazepine.
| Compound Name | 8-chloro-1-(chloromethyl)-5-phenyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzothiazepine |
|---|---|
| PubChem CID | 15651065 |
| Molecular Formula | C17H13Cl2N3S |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 8-chloro-1-(chloromethyl)-5-phenyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzothiazepine |
| SMILES | ClCc1nnc2n1-c1ccc(Cl)cc1SC(c1ccccc1)C2 |
| InChI | InChI=1S/C17H13Cl2N3S/c18-10-17-21-20-16-9-14(11-4-2-1-3-5-11)23-15-8-12(19)6-7-13(15)22(16)17/h1-8,14H,9-10H2 |
| InChIKey | DBXXFDDMCKWWGW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|