C15H23NO5 — CID 156510884
tert-butyl (1S,2R,6S,7R)-2,4,4-trimethyl-9-oxo-3,5-dioxa-8-azatricyclo[5.2.1.02,6]decane-8-carboxylate (PubChem CID 156510884) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is tert-butyl (1S,2R,6S,7R)-2,4,4-trimethyl-9-oxo-3,5-dioxa-8-azatricyclo[5.2.1.02,6]decane-8-carboxylate.
| Compound Name | tert-butyl (1S,2R,6S,7R)-2,4,4-trimethyl-9-oxo-3,5-dioxa-8-azatricyclo[5.2.1.02,6]decane-8-carboxylate |
|---|---|
| PubChem CID | 156510884 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | tert-butyl (1S,2R,6S,7R)-2,4,4-trimethyl-9-oxo-3,5-dioxa-8-azatricyclo[5.2.1.02,6]decane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@H]2C[C@@H]1[C@@H]1OC(C)(C)O[C@]21C |
| InChI | InChI=1S/C15H23NO5/c1-13(2,3)20-12(18)16-9-7-8(11(16)17)15(6)10(9)19-14(4,5)21-15/h8-10H,7H2,1-6H3/t8-,9-,10+,15-/m1/s1 |
| InChIKey | PGRYKXHGSUUZSH-KFRQHLNQSA-N |
| XLogP | 2.06 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |