C33H46N4O2 — CID 156517056
N-[[(4aS,6aR,6bS,12aS,14aR)-11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl]methyl]-N-methanimidoylmethanimidamide (PubChem CID 156517056) has the molecular formula C33H46N4O2 and a molecular weight of 530.76 g/mol. Its IUPAC name is N-[[(4aS,6aR,6bS,12aS,14aR)-11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl]methyl]-N-methanimidoylmethanimidamide.
| Compound Name | N-[[(4aS,6aR,6bS,12aS,14aR)-11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl]methyl]-N-methanimidoylmethanimidamide |
|---|---|
| PubChem CID | 156517056 |
| Molecular Formula | C33H46N4O2 |
| Molecular Weight | 530.76 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | N-[[(4aS,6aR,6bS,12aS,14aR)-11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicen-4a-yl]methyl]-N-methanimidoylmethanimidamide |
| SMILES | [H]/N=C/N(/C=N/[H])C[C@]12CCC(C)(C)CC1[C@H]1C(=O)C=C3[C@@]4(C)C=C(C#N)C(=O)C(C)(C)C4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C33H46N4O2/c1-28(2)10-12-33(18-37(19-35)20-36)13-11-32(7)26(22(33)16-28)23(38)14-25-30(5)15-21(17-34)27(39)29(3,4)24(30)8-9-31(25,32)6/h14-15,19-20,22,24,26,35-36H,8-13,16,18H2,1-7H3/b35-19+,36-20+/t22?,24?,26-,30-,31+,32+,33+/m0/s1 |
| InChIKey | QXJABPHAYBUWCD-CMMPJONBSA-N |
| XLogP | 6.72 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.76 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|