C27H40N4O6 — CID 156518309
3-methyl-N-[[4-[[(2S)-2-[[4-oxo-4-(4-propanoylpiperidin-1-yl)butanoyl]amino]propanoyl]amino]phenyl]methoxy]butanamide (PubChem CID 156518309) has the molecular formula C27H40N4O6 and a molecular weight of 516.64 g/mol. Its IUPAC name is 3-methyl-N-[[4-[[(2S)-2-[[4-oxo-4-(4-propanoylpiperidin-1-yl)butanoyl]amino]propanoyl]amino]phenyl]methoxy]butanamide.
| Compound Name | 3-methyl-N-[[4-[[(2S)-2-[[4-oxo-4-(4-propanoylpiperidin-1-yl)butanoyl]amino]propanoyl]amino]phenyl]methoxy]butanamide |
|---|---|
| PubChem CID | 156518309 |
| Molecular Formula | C27H40N4O6 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | 3-methyl-N-[[4-[[(2S)-2-[[4-oxo-4-(4-propanoylpiperidin-1-yl)butanoyl]amino]propanoyl]amino]phenyl]methoxy]butanamide |
| SMILES | CCC(=O)C1CCN(C(=O)CCC(=O)N[C@@H](C)C(=O)Nc2ccc(CONC(=O)CC(C)C)cc2)CC1 |
| InChI | InChI=1S/C27H40N4O6/c1-5-23(32)21-12-14-31(15-13-21)26(35)11-10-24(33)28-19(4)27(36)29-22-8-6-20(7-9-22)17-37-30-25(34)16-18(2)3/h6-9,18-19,21H,5,10-17H2,1-4H3,(H,28,33)(H,29,36)(H,30,34)/t19-/m0/s1 |
| InChIKey | QTZYHBNJMPMSOF-IBGZPJMESA-N |
| XLogP | 2.72 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|