C29H44N6O7S — CID 144831676
1-[4-[[1-[[1-[4-(formamidooxymethyl)anilino]-5-(methylamino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-oxobutanoyl]piperidine-4-carbothioic S-acid (PubChem CID 144831676) has the molecular formula C29H44N6O7S and a molecular weight of 620.77 g/mol. Its IUPAC name is 1-[4-[[1-[[1-[4-(formamidooxymethyl)anilino]-5-(methylamino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-oxobutanoyl]piperidine-4-carbothioic S-acid.
| Compound Name | 1-[4-[[1-[[1-[4-(formamidooxymethyl)anilino]-5-(methylamino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-oxobutanoyl]piperidine-4-carbothioic S-acid |
|---|---|
| PubChem CID | 144831676 |
| Molecular Formula | C29H44N6O7S |
| Molecular Weight | 620.77 g/mol |
| Exact Mass | 620.30 |
| IUPAC Name | 1-[4-[[1-[[1-[4-(formamidooxymethyl)anilino]-5-(methylamino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-oxobutanoyl]piperidine-4-carbothioic S-acid |
| SMILES | CNCCCC(NC(=O)C(NC(=O)CCC(=O)N1CCC(C(=O)S)CC1)C(C)C)C(=O)Nc1ccc(CONC=O)cc1 |
| InChI | InChI=1S/C29H44N6O7S/c1-19(2)26(34-24(37)10-11-25(38)35-15-12-21(13-16-35)29(41)43)28(40)33-23(5-4-14-30-3)27(39)32-22-8-6-20(7-9-22)17-42-31-18-36/h6-9,18-19,21,23,26,30H,4-5,10-17H2,1-3H3,(H,31,36)(H,32,39)(H,33,40)(H,34,37)(H,41,43) |
| InChIKey | HZPTTXQLGBCZGP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 175.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.77 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|