C12H24N2O2S — CID 156519965
tert-butyl N-[(E)-3-ethylsulfanyl-2-(methylamino)prop-1-enyl]-N-methylcarbamate (PubChem CID 156519965) has the molecular formula C12H24N2O2S and a molecular weight of 260.40 g/mol. Its IUPAC name is tert-butyl N-[(E)-3-ethylsulfanyl-2-(methylamino)prop-1-enyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(E)-3-ethylsulfanyl-2-(methylamino)prop-1-enyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 156519965 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | tert-butyl N-[(E)-3-ethylsulfanyl-2-(methylamino)prop-1-enyl]-N-methylcarbamate |
| SMILES | CCSC/C(=C\N(C)C(=O)OC(C)(C)C)NC |
| InChI | InChI=1S/C12H24N2O2S/c1-7-17-9-10(13-5)8-14(6)11(15)16-12(2,3)4/h8,13H,7,9H2,1-6H3/b10-8+ |
| InChIKey | HNYRVGGYHBDYTN-CSKARUKUSA-N |
| XLogP | 2.67 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |