C17H25NO3S — CID 87652150
tert-butyl N-[4-(ethylsulfanylmethyl)phenyl]-N-(1-oxopropan-2-yl)carbamate (PubChem CID 87652150) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is tert-butyl N-[4-(ethylsulfanylmethyl)phenyl]-N-(1-oxopropan-2-yl)carbamate.
| Compound Name | tert-butyl N-[4-(ethylsulfanylmethyl)phenyl]-N-(1-oxopropan-2-yl)carbamate |
|---|---|
| PubChem CID | 87652150 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | tert-butyl N-[4-(ethylsulfanylmethyl)phenyl]-N-(1-oxopropan-2-yl)carbamate |
| SMILES | CCSCc1ccc(N(C(=O)OC(C)(C)C)C(C)C=O)cc1 |
| InChI | InChI=1S/C17H25NO3S/c1-6-22-12-14-7-9-15(10-8-14)18(13(2)11-19)16(20)21-17(3,4)5/h7-11,13H,6,12H2,1-5H3 |
| InChIKey | KDVXLJQKZBCBJI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|