C18H14Cl2F2N2O3S2 — CID 156520097
6-chloro-7-(5-chloro-2,4-difluorophenyl)-8-(3-hydroxy-2-methylsulfanylpropyl)sulfanyl-1H-quinazoline-2,4-dione (PubChem CID 156520097) has the molecular formula C18H14Cl2F2N2O3S2 and a molecular weight of 479.36 g/mol. Its IUPAC name is 6-chloro-7-(5-chloro-2,4-difluorophenyl)-8-(3-hydroxy-2-methylsulfanylpropyl)sulfanyl-1H-quinazoline-2,4-dione.
| Compound Name | 6-chloro-7-(5-chloro-2,4-difluorophenyl)-8-(3-hydroxy-2-methylsulfanylpropyl)sulfanyl-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 156520097 |
| Molecular Formula | C18H14Cl2F2N2O3S2 |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 477.98 |
| IUPAC Name | 6-chloro-7-(5-chloro-2,4-difluorophenyl)-8-(3-hydroxy-2-methylsulfanylpropyl)sulfanyl-1H-quinazoline-2,4-dione |
| SMILES | CSC(CO)CSc1c(-c2cc(Cl)c(F)cc2F)c(Cl)cc2c(=O)[nH]c(=O)[nH]c12 |
| InChI | InChI=1S/C18H14Cl2F2N2O3S2/c1-28-7(5-25)6-29-16-14(8-2-10(19)13(22)4-12(8)21)11(20)3-9-15(16)23-18(27)24-17(9)26/h2-4,7,25H,5-6H2,1H3,(H2,23,24,26,27) |
| InChIKey | ZCVMUJMZWHOASM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|