C15H6ClF4IN2O2 — CID 164542125
7-(3-chloro-4-fluorophenyl)-8-iodo-6-(trifluoromethyl)-1H-quinazoline-2,4-dione (PubChem CID 164542125) has the molecular formula C15H6ClF4IN2O2 and a molecular weight of 484.57 g/mol. Its IUPAC name is 7-(3-chloro-4-fluorophenyl)-8-iodo-6-(trifluoromethyl)-1H-quinazoline-2,4-dione.
| Compound Name | 7-(3-chloro-4-fluorophenyl)-8-iodo-6-(trifluoromethyl)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 164542125 |
| Molecular Formula | C15H6ClF4IN2O2 |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 483.91 |
| IUPAC Name | 7-(3-chloro-4-fluorophenyl)-8-iodo-6-(trifluoromethyl)-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c(=O)c2cc(C(F)(F)F)c(-c3ccc(F)c(Cl)c3)c(I)c2[nH]1 |
| InChI | InChI=1S/C15H6ClF4IN2O2/c16-8-3-5(1-2-9(8)17)10-7(15(18,19)20)4-6-12(11(10)21)22-14(25)23-13(6)24/h1-4H,(H2,22,23,24,25) |
| InChIKey | PBMHFGWCLNAYMK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|