C20H15ClF4N2O4S — CID 164541512
(12S)-8-(3-chloro-4-fluorophenyl)-12-(methoxymethoxy)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-triene-2,4-dione (PubChem CID 164541512) has the molecular formula C20H15ClF4N2O4S and a molecular weight of 490.86 g/mol. Its IUPAC name is (12S)-8-(3-chloro-4-fluorophenyl)-12-(methoxymethoxy)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-triene-2,4-dione.
| Compound Name | (12S)-8-(3-chloro-4-fluorophenyl)-12-(methoxymethoxy)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-triene-2,4-dione |
|---|---|
| PubChem CID | 164541512 |
| Molecular Formula | C20H15ClF4N2O4S |
| Molecular Weight | 490.86 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | (12S)-8-(3-chloro-4-fluorophenyl)-12-(methoxymethoxy)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-triene-2,4-dione |
| SMILES | COCO[C@@H]1CSc2c(-c3ccc(F)c(Cl)c3)c(C(F)(F)F)cc3c(=O)[nH]c(=O)n(c23)C1 |
| InChI | InChI=1S/C20H15ClF4N2O4S/c1-30-8-31-10-6-27-16-11(18(28)26-19(27)29)5-12(20(23,24)25)15(17(16)32-7-10)9-2-3-14(22)13(21)4-9/h2-5,10H,6-8H2,1H3,(H,26,28,29)/t10-/m0/s1 |
| InChIKey | OMWUKEHGKLZRFF-JTQLQIEISA-N |
| XLogP | 4.26 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.86 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|