C19H13ClF4N2O3S — CID 164541432
(12R)-8-(3-chloro-4-fluorophenyl)-12-methoxy-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-triene-2,4-dione (PubChem CID 164541432) has the molecular formula C19H13ClF4N2O3S and a molecular weight of 460.84 g/mol. Its IUPAC name is (12R)-8-(3-chloro-4-fluorophenyl)-12-methoxy-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-triene-2,4-dione.
| Compound Name | (12R)-8-(3-chloro-4-fluorophenyl)-12-methoxy-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-triene-2,4-dione |
|---|---|
| PubChem CID | 164541432 |
| Molecular Formula | C19H13ClF4N2O3S |
| Molecular Weight | 460.84 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | (12R)-8-(3-chloro-4-fluorophenyl)-12-methoxy-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-triene-2,4-dione |
| SMILES | CO[C@H]1CSc2c(-c3ccc(F)c(Cl)c3)c(C(F)(F)F)cc3c(=O)[nH]c(=O)n(c23)C1 |
| InChI | InChI=1S/C19H13ClF4N2O3S/c1-29-9-6-26-15-10(17(27)25-18(26)28)5-11(19(22,23)24)14(16(15)30-7-9)8-2-3-13(21)12(20)4-8/h2-5,9H,6-7H2,1H3,(H,25,27,28)/t9-/m1/s1 |
| InChIKey | WGSSDGNICNWREB-SECBINFHSA-N |
| XLogP | 4.29 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.84 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |