C20H16F5N3O2S — CID 156520113
8-(2,4-difluorophenyl)-12-(dimethylamino)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-triene-2,4-dione (PubChem CID 156520113) has the molecular formula C20H16F5N3O2S and a molecular weight of 457.42 g/mol. Its IUPAC name is 8-(2,4-difluorophenyl)-12-(dimethylamino)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-triene-2,4-dione.
| Compound Name | 8-(2,4-difluorophenyl)-12-(dimethylamino)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-triene-2,4-dione |
|---|---|
| PubChem CID | 156520113 |
| Molecular Formula | C20H16F5N3O2S |
| Molecular Weight | 457.42 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 8-(2,4-difluorophenyl)-12-(dimethylamino)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-triene-2,4-dione |
| SMILES | CN(C)C1CSc2c(-c3ccc(F)cc3F)c(C(F)(F)F)cc3c(=O)[nH]c(=O)n(c23)C1 |
| InChI | InChI=1S/C20H16F5N3O2S/c1-27(2)10-7-28-16-12(18(29)26-19(28)30)6-13(20(23,24)25)15(17(16)31-8-10)11-4-3-9(21)5-14(11)22/h3-6,10H,7-8H2,1-2H3,(H,26,29,30) |
| InChIKey | HVZSRQPSQISNTB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |