C19H11F4N3O2S — CID 164542124
2-[2,4-dioxo-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-trien-8-yl]-5-fluorobenzonitrile (PubChem CID 164542124) has the molecular formula C19H11F4N3O2S and a molecular weight of 421.38 g/mol. Its IUPAC name is 2-[2,4-dioxo-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-trien-8-yl]-5-fluorobenzonitrile.
| Compound Name | 2-[2,4-dioxo-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-trien-8-yl]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 164542124 |
| Molecular Formula | C19H11F4N3O2S |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | 2-[2,4-dioxo-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14)-trien-8-yl]-5-fluorobenzonitrile |
| SMILES | N#Cc1cc(F)ccc1-c1c(C(F)(F)F)cc2c(=O)[nH]c(=O)n3c2c1SCCC3 |
| InChI | InChI=1S/C19H11F4N3O2S/c20-10-2-3-11(9(6-10)8-24)14-13(19(21,22)23)7-12-15-16(14)29-5-1-4-26(15)18(28)25-17(12)27/h2-3,6-7H,1,4-5H2,(H,25,27,28) |
| InChIKey | UAWLNOVFMWUDGN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |