C18H10F4N2O2S — CID 156520656
8-(4-fluorophenyl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14),12-tetraene-2,4-dione (PubChem CID 156520656) has the molecular formula C18H10F4N2O2S and a molecular weight of 394.35 g/mol. Its IUPAC name is 8-(4-fluorophenyl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14),12-tetraene-2,4-dione.
| Compound Name | 8-(4-fluorophenyl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14),12-tetraene-2,4-dione |
|---|---|
| PubChem CID | 156520656 |
| Molecular Formula | C18H10F4N2O2S |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 8-(4-fluorophenyl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-5,7,9(14),12-tetraene-2,4-dione |
| SMILES | O=c1[nH]c(=O)n2c3c(c(-c4ccc(F)cc4)c(C(F)(F)F)cc13)SCC=C2 |
| InChI | InChI=1S/C18H10F4N2O2S/c19-10-4-2-9(3-5-10)13-12(18(20,21)22)8-11-14-15(13)27-7-1-6-24(14)17(26)23-16(11)25/h1-6,8H,7H2,(H,23,25,26) |
| InChIKey | MNICHENKGSLHRJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |