C21H18F5N3O2S — CID 165074338
(12S)-8-(2,4-difluorophenyl)-7-methyl-12-[methyl(2,2,2-trifluoroethyl)amino]-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-5(14),6,8-triene-2,4-dione (PubChem CID 165074338) has the molecular formula C21H18F5N3O2S and a molecular weight of 471.45 g/mol. Its IUPAC name is (12S)-8-(2,4-difluorophenyl)-7-methyl-12-[methyl(2,2,2-trifluoroethyl)amino]-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-5(14),6,8-triene-2,4-dione.
| Compound Name | (12S)-8-(2,4-difluorophenyl)-7-methyl-12-[methyl(2,2,2-trifluoroethyl)amino]-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-5(14),6,8-triene-2,4-dione |
|---|---|
| PubChem CID | 165074338 |
| Molecular Formula | C21H18F5N3O2S |
| Molecular Weight | 471.45 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | (12S)-8-(2,4-difluorophenyl)-7-methyl-12-[methyl(2,2,2-trifluoroethyl)amino]-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-5(14),6,8-triene-2,4-dione |
| SMILES | Cc1cc2c(=O)[nH]c(=O)n3c2c(c1-c1ccc(F)cc1F)SC[C@@H](N(C)CC(F)(F)F)C3 |
| InChI | InChI=1S/C21H18F5N3O2S/c1-10-5-14-17-18(16(10)13-4-3-11(22)6-15(13)23)32-8-12(28(2)9-21(24,25)26)7-29(17)20(31)27-19(14)30/h3-6,12H,7-9H2,1-2H3,(H,27,30,31)/t12-/m0/s1 |
| InChIKey | UBAOATNNHUCRMS-LBPRGKRZSA-N |
| XLogP | 3.91 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |