C19H12ClF5N2O4S — CID 156520954
8-(5-chloro-2,4-difluorophenyl)-12-(hydroxymethyl)-12-methoxy-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2,4-dione (PubChem CID 156520954) has the molecular formula C19H12ClF5N2O4S and a molecular weight of 494.83 g/mol. Its IUPAC name is 8-(5-chloro-2,4-difluorophenyl)-12-(hydroxymethyl)-12-methoxy-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2,4-dione.
| Compound Name | 8-(5-chloro-2,4-difluorophenyl)-12-(hydroxymethyl)-12-methoxy-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2,4-dione |
|---|---|
| PubChem CID | 156520954 |
| Molecular Formula | C19H12ClF5N2O4S |
| Molecular Weight | 494.83 g/mol |
| Exact Mass | 494.01 |
| IUPAC Name | 8-(5-chloro-2,4-difluorophenyl)-12-(hydroxymethyl)-12-methoxy-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2,4-dione |
| SMILES | COC1(CO)CSc2c(-c3cc(Cl)c(F)cc3F)c(C(F)(F)F)cc3c(=O)[nH]c(=O)n1c23 |
| InChI | InChI=1S/C19H12ClF5N2O4S/c1-31-18(5-28)6-32-15-13(7-3-10(20)12(22)4-11(7)21)9(19(23,24)25)2-8-14(15)27(18)17(30)26-16(8)29/h2-4,28H,5-6H2,1H3,(H,26,29,30) |
| InChIKey | AVAYLOLAEOAYCG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.83 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|