C25H24ClF5N4O2S — CID 156521323
(12S)-8-(5-chloro-2,4-difluorophenyl)-4-[(2S)-2,4-dimethylpiperazin-1-yl]-12-methoxy-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one (PubChem CID 156521323) has the molecular formula C25H24ClF5N4O2S and a molecular weight of 575.00 g/mol. Its IUPAC name is (12S)-8-(5-chloro-2,4-difluorophenyl)-4-[(2S)-2,4-dimethylpiperazin-1-yl]-12-methoxy-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one.
| Compound Name | (12S)-8-(5-chloro-2,4-difluorophenyl)-4-[(2S)-2,4-dimethylpiperazin-1-yl]-12-methoxy-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one |
|---|---|
| PubChem CID | 156521323 |
| Molecular Formula | C25H24ClF5N4O2S |
| Molecular Weight | 575.00 g/mol |
| Exact Mass | 574.12 |
| IUPAC Name | (12S)-8-(5-chloro-2,4-difluorophenyl)-4-[(2S)-2,4-dimethylpiperazin-1-yl]-12-methoxy-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one |
| SMILES | CO[C@@H]1CSc2c(-c3cc(Cl)c(F)cc3F)c(C(F)(F)F)cc3c(N4CCN(C)C[C@@H]4C)nc(=O)n(c23)C1 |
| InChI | InChI=1S/C25H24ClF5N4O2S/c1-12-9-33(2)4-5-34(12)23-15-6-16(25(29,30)31)20(14-7-17(26)19(28)8-18(14)27)22-21(15)35(24(36)32-23)10-13(37-3)11-38-22/h6-8,12-13H,4-5,9-11H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | GHIVAVJELXOEHC-STQMWFEESA-N |
| XLogP | 5.27 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.00 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|