C25H26ClF2N3O2S — CID 165029329
(12S)-8-(5-chloro-2,4-difluorophenyl)-12-methoxy-7-methyl-4-[(2S)-2-methylpiperidin-1-yl]-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5(14),6,8-tetraen-2-one (PubChem CID 165029329) has the molecular formula C25H26ClF2N3O2S and a molecular weight of 506.02 g/mol. Its IUPAC name is (12S)-8-(5-chloro-2,4-difluorophenyl)-12-methoxy-7-methyl-4-[(2S)-2-methylpiperidin-1-yl]-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5(14),6,8-tetraen-2-one.
| Compound Name | (12S)-8-(5-chloro-2,4-difluorophenyl)-12-methoxy-7-methyl-4-[(2S)-2-methylpiperidin-1-yl]-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5(14),6,8-tetraen-2-one |
|---|---|
| PubChem CID | 165029329 |
| Molecular Formula | C25H26ClF2N3O2S |
| Molecular Weight | 506.02 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | (12S)-8-(5-chloro-2,4-difluorophenyl)-12-methoxy-7-methyl-4-[(2S)-2-methylpiperidin-1-yl]-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5(14),6,8-tetraen-2-one |
| SMILES | CO[C@@H]1CSc2c(-c3cc(Cl)c(F)cc3F)c(C)cc3c(N4CCCC[C@@H]4C)nc(=O)n(c23)C1 |
| InChI | InChI=1S/C25H26ClF2N3O2S/c1-13-8-17-22-23(21(13)16-9-18(26)20(28)10-19(16)27)34-12-15(33-3)11-31(22)25(32)29-24(17)30-7-5-4-6-14(30)2/h8-10,14-15H,4-7,11-12H2,1-3H3/t14-,15-/m0/s1 |
| InChIKey | MJWIVCBDJYKYDC-GJZGRUSLSA-N |
| XLogP | 5.80 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.02 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|