C28H30Cl2F2N4O4S — CID 164542002
tert-butyl (3S)-4-[(12S)-7-chloro-8-(5-chloro-2,4-difluorophenyl)-12-methoxy-2-oxo-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-4-yl]-3-methylpiperazine-1-carboxylate (PubChem CID 164542002) has the molecular formula C28H30Cl2F2N4O4S and a molecular weight of 627.54 g/mol. Its IUPAC name is tert-butyl (3S)-4-[(12S)-7-chloro-8-(5-chloro-2,4-difluorophenyl)-12-methoxy-2-oxo-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-4-yl]-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-4-[(12S)-7-chloro-8-(5-chloro-2,4-difluorophenyl)-12-methoxy-2-oxo-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-4-yl]-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 164542002 |
| Molecular Formula | C28H30Cl2F2N4O4S |
| Molecular Weight | 627.54 g/mol |
| Exact Mass | 626.13 |
| IUPAC Name | tert-butyl (3S)-4-[(12S)-7-chloro-8-(5-chloro-2,4-difluorophenyl)-12-methoxy-2-oxo-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-4-yl]-3-methylpiperazine-1-carboxylate |
| SMILES | CO[C@@H]1CSc2c(-c3cc(Cl)c(F)cc3F)c(Cl)cc3c(N4CCN(C(=O)OC(C)(C)C)C[C@@H]4C)nc(=O)n(c23)C1 |
| InChI | InChI=1S/C28H30Cl2F2N4O4S/c1-14-11-34(27(38)40-28(2,3)4)6-7-35(14)25-17-9-19(30)22(16-8-18(29)21(32)10-20(16)31)24-23(17)36(26(37)33-25)12-15(39-5)13-41-24/h8-10,14-15H,6-7,11-13H2,1-5H3/t14-,15-/m0/s1 |
| InChIKey | XSNQDWSWWXUGOR-GJZGRUSLSA-N |
| XLogP | 6.21 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.54 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|