C27H28Cl2F2N4O4S — CID 156521185
tert-butyl 4-[(12R)-7-chloro-8-(5-chloro-2,4-difluorophenyl)-12-methoxy-2-oxo-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-4-yl]piperazine-1-carboxylate (PubChem CID 156521185) has the molecular formula C27H28Cl2F2N4O4S and a molecular weight of 613.51 g/mol. Its IUPAC name is tert-butyl 4-[(12R)-7-chloro-8-(5-chloro-2,4-difluorophenyl)-12-methoxy-2-oxo-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(12R)-7-chloro-8-(5-chloro-2,4-difluorophenyl)-12-methoxy-2-oxo-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 156521185 |
| Molecular Formula | C27H28Cl2F2N4O4S |
| Molecular Weight | 613.51 g/mol |
| Exact Mass | 612.12 |
| IUPAC Name | tert-butyl 4-[(12R)-7-chloro-8-(5-chloro-2,4-difluorophenyl)-12-methoxy-2-oxo-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-4-yl]piperazine-1-carboxylate |
| SMILES | CO[C@H]1CSc2c(-c3cc(Cl)c(F)cc3F)c(Cl)cc3c(N4CCN(C(=O)OC(C)(C)C)CC4)nc(=O)n(c23)C1 |
| InChI | InChI=1S/C27H28Cl2F2N4O4S/c1-27(2,3)39-26(37)34-7-5-33(6-8-34)24-16-10-18(29)21(15-9-17(28)20(31)11-19(15)30)23-22(16)35(25(36)32-24)12-14(38-4)13-40-23/h9-11,14H,5-8,12-13H2,1-4H3/t14-/m1/s1 |
| InChIKey | AOAUDBNWDFEWMI-CQSZACIVSA-N |
| XLogP | 5.83 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.51 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|