C30H33F5N4O5S — CID 167115557
tert-butyl 4-[8-(2,4-difluorophenyl)-12-(2-methoxyethoxy)-2-oxo-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-4-yl]piperazine-1-carboxylate (PubChem CID 167115557) has the molecular formula C30H33F5N4O5S and a molecular weight of 656.67 g/mol. Its IUPAC name is tert-butyl 4-[8-(2,4-difluorophenyl)-12-(2-methoxyethoxy)-2-oxo-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[8-(2,4-difluorophenyl)-12-(2-methoxyethoxy)-2-oxo-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 167115557 |
| Molecular Formula | C30H33F5N4O5S |
| Molecular Weight | 656.67 g/mol |
| Exact Mass | 656.21 |
| IUPAC Name | tert-butyl 4-[8-(2,4-difluorophenyl)-12-(2-methoxyethoxy)-2-oxo-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-4-yl]piperazine-1-carboxylate |
| SMILES | COCCOC1CSc2c(-c3ccc(F)cc3F)c(C(F)(F)F)cc3c(N4CCN(C(=O)OC(C)(C)C)CC4)nc(=O)n(c23)C1 |
| InChI | InChI=1S/C30H33F5N4O5S/c1-29(2,3)44-28(41)38-9-7-37(8-10-38)26-20-14-21(30(33,34)35)23(19-6-5-17(31)13-22(19)32)25-24(20)39(27(40)36-26)15-18(16-45-25)43-12-11-42-4/h5-6,13-14,18H,7-12,15-16H2,1-4H3 |
| InChIKey | XZJAYSGOJHAGJI-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 86.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.67 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|