About CID 169267971
CID 169267971 (PubChem CID 169267971) has the molecular formula C11H8ClF3N2O3SSi
and a molecular weight of 368.80 g/mol.
Molecular Properties
| Compound Name | CID 169267971 |
| PubChem CID | 169267971 |
| Molecular Formula | C11H8ClF3N2O3SSi |
| Molecular Weight | 368.80 g/mol |
| Exact Mass | 367.97 |
| IUPAC Name | — |
| SMILES | O=c1[nH]c(=O)c2cc(C(F)(F)F)c(Cl)c(SC[Si]CO)c2[nH]1 |
| InChI | InChI=1S/C11H8ClF3N2O3SSi/c12-6-5(11(13,14)15)1-4-7(8(6)21-3-22-2-18)16-10(20)17-9(4)19/h1,18H,2-3H2,(H2,16,17,19,20) |
| InChIKey | KPWCBGDWHFMGRK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.80 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 169267971 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169267971?
The IUPAC name of CID 169267971 (CID 169267971) is not available.
What is the SMILES notation for CID 169267971?
The canonical SMILES for CID 169267971 is O=c1[nH]c(=O)c2cc(C(F)(F)F)c(Cl)c(SC[Si]CO)c2[nH]1.
What is the InChIKey of CID 169267971?
The InChIKey is KPWCBGDWHFMGRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClF3N2O3SSi/c12-6-5(11(13,14)15)1-4-7(8(6)21-3-22-2-18)16-10(20)17-9(4)19/h1,18H,2-3H2,(H2,16,17,19,20).
What are the key properties of CID 169267971?
CID 169267971 has a molecular weight of 368.80 g/mol, XLogP of 1.59, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169267971 is sourced from PubChem (CID 169267971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).