C11H8ClF3N2O3SSi — CID 169267971
CID 169267971 (PubChem CID 169267971) has the molecular formula C11H8ClF3N2O3SSi and a molecular weight of 368.80 g/mol.
| Compound Name | CID 169267971 |
|---|---|
| PubChem CID | 169267971 |
| Molecular Formula | C11H8ClF3N2O3SSi |
| Molecular Weight | 368.80 g/mol |
| Exact Mass | 367.97 |
| IUPAC Name | — |
| SMILES | O=c1[nH]c(=O)c2cc(C(F)(F)F)c(Cl)c(SC[Si]CO)c2[nH]1 |
| InChI | InChI=1S/C11H8ClF3N2O3SSi/c12-6-5(11(13,14)15)1-4-7(8(6)21-3-22-2-18)16-10(20)17-9(4)19/h1,18H,2-3H2,(H2,16,17,19,20) |
| InChIKey | KPWCBGDWHFMGRK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.80 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|