C14H6F4IN3O2 — CID 164541776
7-(5-fluoro-2-pyridinyl)-8-iodo-6-(trifluoromethyl)-1H-quinazoline-2,4-dione (PubChem CID 164541776) has the molecular formula C14H6F4IN3O2 and a molecular weight of 451.12 g/mol. Its IUPAC name is 7-(5-fluoro-2-pyridinyl)-8-iodo-6-(trifluoromethyl)-1H-quinazoline-2,4-dione.
| Compound Name | 7-(5-fluoro-2-pyridinyl)-8-iodo-6-(trifluoromethyl)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 164541776 |
| Molecular Formula | C14H6F4IN3O2 |
| Molecular Weight | 451.12 g/mol |
| Exact Mass | 450.94 |
| IUPAC Name | 7-(5-fluoro-2-pyridinyl)-8-iodo-6-(trifluoromethyl)-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c(=O)c2cc(C(F)(F)F)c(-c3ccc(F)cn3)c(I)c2[nH]1 |
| InChI | InChI=1S/C14H6F4IN3O2/c15-5-1-2-8(20-4-5)9-7(14(16,17)18)3-6-11(10(9)19)21-13(24)22-12(6)23/h1-4H,(H2,21,22,23,24) |
| InChIKey | KXCIEWMTCLVDNN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.12 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|