C9H6FN3O2 — CID 83128935
6-(5-fluoro-2-pyridinyl)-1H-pyrimidine-2,4-dione (PubChem CID 83128935) has the molecular formula C9H6FN3O2 and a molecular weight of 207.16 g/mol. Its IUPAC name is 6-(5-fluoro-2-pyridinyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(5-fluoro-2-pyridinyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 83128935 |
| Molecular Formula | C9H6FN3O2 |
| Molecular Weight | 207.16 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 6-(5-fluoro-2-pyridinyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1cc(-c2ccc(F)cn2)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C9H6FN3O2/c10-5-1-2-6(11-4-5)7-3-8(14)13-9(15)12-7/h1-4H,(H2,12,13,14,15) |
| InChIKey | BFPXFXNZCFDZLK-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.16 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |