C20H18F4N2O5S — CID 164541921
7-(4-fluorophenyl)-8-[(2S)-3-hydroxy-2-(methoxymethoxy)propyl]sulfanyl-6-(trifluoromethyl)-1H-quinazoline-2,4-dione (PubChem CID 164541921) has the molecular formula C20H18F4N2O5S and a molecular weight of 474.43 g/mol. Its IUPAC name is 7-(4-fluorophenyl)-8-[(2S)-3-hydroxy-2-(methoxymethoxy)propyl]sulfanyl-6-(trifluoromethyl)-1H-quinazoline-2,4-dione.
| Compound Name | 7-(4-fluorophenyl)-8-[(2S)-3-hydroxy-2-(methoxymethoxy)propyl]sulfanyl-6-(trifluoromethyl)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 164541921 |
| Molecular Formula | C20H18F4N2O5S |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | 7-(4-fluorophenyl)-8-[(2S)-3-hydroxy-2-(methoxymethoxy)propyl]sulfanyl-6-(trifluoromethyl)-1H-quinazoline-2,4-dione |
| SMILES | COCO[C@@H](CO)CSc1c(-c2ccc(F)cc2)c(C(F)(F)F)cc2c(=O)[nH]c(=O)[nH]c12 |
| InChI | InChI=1S/C20H18F4N2O5S/c1-30-9-31-12(7-27)8-32-17-15(10-2-4-11(21)5-3-10)14(20(22,23)24)6-13-16(17)25-19(29)26-18(13)28/h2-6,12,27H,7-9H2,1H3,(H2,25,26,28,29)/t12-/m0/s1 |
| InChIKey | XUMBZGYDEXECKR-LBPRGKRZSA-N |
| XLogP | 3.11 |
| TPSA | 104.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|