C10H25N5 — CID 156522931
8-methylcyclononane-1,2,3,4,6-pentamine (PubChem CID 156522931) has the molecular formula C10H25N5 and a molecular weight of 215.34 g/mol. Its IUPAC name is 8-methylcyclononane-1,2,3,4,6-pentamine.
| Compound Name | 8-methylcyclononane-1,2,3,4,6-pentamine |
|---|---|
| PubChem CID | 156522931 |
| Molecular Formula | C10H25N5 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.21 |
| IUPAC Name | 8-methylcyclononane-1,2,3,4,6-pentamine |
| SMILES | CC1CC(N)CC(N)C(N)C(N)C(N)C1 |
| InChI | InChI=1S/C10H25N5/c1-5-2-6(11)4-8(13)10(15)9(14)7(12)3-5/h5-10H,2-4,11-15H2,1H3 |
| InChIKey | AUKUPURTIXFMNO-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 130.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |