C18H23F2IO4 — CID 156523095
(2,2-difluoro-4-methyl-1-oxo-1-propoxypentan-3-yl) 3-iodo-2,5-dimethylbenzoate (PubChem CID 156523095) has the molecular formula C18H23F2IO4 and a molecular weight of 468.28 g/mol. Its IUPAC name is (2,2-difluoro-4-methyl-1-oxo-1-propoxypentan-3-yl) 3-iodo-2,5-dimethylbenzoate.
| Compound Name | (2,2-difluoro-4-methyl-1-oxo-1-propoxypentan-3-yl) 3-iodo-2,5-dimethylbenzoate |
|---|---|
| PubChem CID | 156523095 |
| Molecular Formula | C18H23F2IO4 |
| Molecular Weight | 468.28 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | (2,2-difluoro-4-methyl-1-oxo-1-propoxypentan-3-yl) 3-iodo-2,5-dimethylbenzoate |
| SMILES | CCCOC(=O)C(F)(F)C(OC(=O)c1cc(C)cc(I)c1C)C(C)C |
| InChI | InChI=1S/C18H23F2IO4/c1-6-7-24-17(23)18(19,20)15(10(2)3)25-16(22)13-8-11(4)9-14(21)12(13)5/h8-10,15H,6-7H2,1-5H3 |
| InChIKey | BTZIPLAURUYYSD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.28 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|