C22H24F3N5O — CID 156526760
(1S)-N'-[7-(3-methylmorpholin-4-yl)phthalazin-1-yl]-1-[2-methyl-3-(trifluoromethyl)phenyl]methanediamine (PubChem CID 156526760) has the molecular formula C22H24F3N5O and a molecular weight of 431.46 g/mol. Its IUPAC name is (1S)-N'-[7-(3-methylmorpholin-4-yl)phthalazin-1-yl]-1-[2-methyl-3-(trifluoromethyl)phenyl]methanediamine.
| Compound Name | (1S)-N'-[7-(3-methylmorpholin-4-yl)phthalazin-1-yl]-1-[2-methyl-3-(trifluoromethyl)phenyl]methanediamine |
|---|---|
| PubChem CID | 156526760 |
| Molecular Formula | C22H24F3N5O |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | (1S)-N'-[7-(3-methylmorpholin-4-yl)phthalazin-1-yl]-1-[2-methyl-3-(trifluoromethyl)phenyl]methanediamine |
| SMILES | Cc1c([C@@H](N)Nc2nncc3ccc(N4CCOCC4C)cc23)cccc1C(F)(F)F |
| InChI | InChI=1S/C22H24F3N5O/c1-13-12-31-9-8-30(13)16-7-6-15-11-27-29-21(18(15)10-16)28-20(26)17-4-3-5-19(14(17)2)22(23,24)25/h3-7,10-11,13,20H,8-9,12,26H2,1-2H3,(H,28,29)/t13?,20-/m0/s1 |
| InChIKey | VYRNYOXKKNWZKD-JDOQCHFPSA-N |
| XLogP | 4.25 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|