C13H15IN4O2 — CID 156528051
3-[(6-iodo-1,2,3,4-tetrahydroquinazolin-2-yl)amino]piperidine-2,6-dione (PubChem CID 156528051) has the molecular formula C13H15IN4O2 and a molecular weight of 386.19 g/mol. Its IUPAC name is 3-[(6-iodo-1,2,3,4-tetrahydroquinazolin-2-yl)amino]piperidine-2,6-dione.
| Compound Name | 3-[(6-iodo-1,2,3,4-tetrahydroquinazolin-2-yl)amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 156528051 |
| Molecular Formula | C13H15IN4O2 |
| Molecular Weight | 386.19 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 3-[(6-iodo-1,2,3,4-tetrahydroquinazolin-2-yl)amino]piperidine-2,6-dione |
| SMILES | O=C1CCC(NC2NCc3cc(I)ccc3N2)C(=O)N1 |
| InChI | InChI=1S/C13H15IN4O2/c14-8-1-2-9-7(5-8)6-15-13(16-9)17-10-3-4-11(19)18-12(10)20/h1-2,5,10,13,15-17H,3-4,6H2,(H,18,19,20) |
| InChIKey | HSRMTLJVUOAICW-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.19 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|