C15H14FN2O5PS — CID 156528839
[5-fluoro-3-[4-[(1R)-1-hydroxypropyl]-1,3-thiazole-2-carbonyl]indol-1-yl]phosphonic acid (PubChem CID 156528839) has the molecular formula C15H14FN2O5PS and a molecular weight of 384.33 g/mol. Its IUPAC name is [5-fluoro-3-[4-[(1R)-1-hydroxypropyl]-1,3-thiazole-2-carbonyl]indol-1-yl]phosphonic acid.
| Compound Name | [5-fluoro-3-[4-[(1R)-1-hydroxypropyl]-1,3-thiazole-2-carbonyl]indol-1-yl]phosphonic acid |
|---|---|
| PubChem CID | 156528839 |
| Molecular Formula | C15H14FN2O5PS |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | [5-fluoro-3-[4-[(1R)-1-hydroxypropyl]-1,3-thiazole-2-carbonyl]indol-1-yl]phosphonic acid |
| SMILES | CC[C@@H](O)c1csc(C(=O)c2cn(P(=O)(O)O)c3ccc(F)cc23)n1 |
| InChI | InChI=1S/C15H14FN2O5PS/c1-2-13(19)11-7-25-15(17-11)14(20)10-6-18(24(21,22)23)12-4-3-8(16)5-9(10)12/h3-7,13,19H,2H2,1H3,(H2,21,22,23)/t13-/m1/s1 |
| InChIKey | JBIHENGZVGFNAD-CYBMUJFWSA-N |
| XLogP | 2.85 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|