C22H20FN2O6PS — CID 156529335
[4-[[6-fluoro-3-[4-[(1R)-1-hydroxypropyl]-1,3-thiazole-2-carbonyl]indol-1-yl]methyl]phenyl] dihydrogen phosphate (PubChem CID 156529335) has the molecular formula C22H20FN2O6PS and a molecular weight of 490.45 g/mol. Its IUPAC name is [4-[[6-fluoro-3-[4-[(1R)-1-hydroxypropyl]-1,3-thiazole-2-carbonyl]indol-1-yl]methyl]phenyl] dihydrogen phosphate.
| Compound Name | [4-[[6-fluoro-3-[4-[(1R)-1-hydroxypropyl]-1,3-thiazole-2-carbonyl]indol-1-yl]methyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 156529335 |
| Molecular Formula | C22H20FN2O6PS |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | [4-[[6-fluoro-3-[4-[(1R)-1-hydroxypropyl]-1,3-thiazole-2-carbonyl]indol-1-yl]methyl]phenyl] dihydrogen phosphate |
| SMILES | CC[C@@H](O)c1csc(C(=O)c2cn(Cc3ccc(OP(=O)(O)O)cc3)c3cc(F)ccc23)n1 |
| InChI | InChI=1S/C22H20FN2O6PS/c1-2-20(26)18-12-33-22(24-18)21(27)17-11-25(19-9-14(23)5-8-16(17)19)10-13-3-6-15(7-4-13)31-32(28,29)30/h3-9,11-12,20,26H,2,10H2,1H3,(H2,28,29,30)/t20-/m1/s1 |
| InChIKey | LFDMDDQAUKIKNW-HXUWFJFHSA-N |
| XLogP | 4.43 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|