C26H27N9 — CID 156529099
1-[4-[3-[6-[carbamimidoyl(methyl)amino]-1H-benzimidazol-2-yl]-1H-indol-5-yl]phenyl]-1,2-dimethylguanidine (PubChem CID 156529099) has the molecular formula C26H27N9 and a molecular weight of 465.57 g/mol. Its IUPAC name is 1-[4-[3-[6-[carbamimidoyl(methyl)amino]-1H-benzimidazol-2-yl]-1H-indol-5-yl]phenyl]-1,2-dimethylguanidine.
| Compound Name | 1-[4-[3-[6-[carbamimidoyl(methyl)amino]-1H-benzimidazol-2-yl]-1H-indol-5-yl]phenyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 156529099 |
| Molecular Formula | C26H27N9 |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 1-[4-[3-[6-[carbamimidoyl(methyl)amino]-1H-benzimidazol-2-yl]-1H-indol-5-yl]phenyl]-1,2-dimethylguanidine |
| SMILES | [H]/N=C(\N)N(C)c1ccc2nc(-c3c[nH]c4ccc(-c5ccc(N(C)/C(N)=N/C)cc5)cc34)[nH]c2c1 |
| InChI | InChI=1S/C26H27N9/c1-30-26(29)35(3)17-7-4-15(5-8-17)16-6-10-21-19(12-16)20(14-31-21)24-32-22-11-9-18(13-23(22)33-24)34(2)25(27)28/h4-14,31H,1-3H3,(H3,27,28)(H2,29,30)(H,32,33) |
| InChIKey | UZKBDBZGMROEDI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 139.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|