C27H29N9 — CID 156529017
1-[2-[5-[4-[carbamimidoyl(methyl)amino]phenyl]-1H-indol-3-yl]-3H-benzimidazol-5-yl]-1,3,3-trimethylguanidine (PubChem CID 156529017) has the molecular formula C27H29N9 and a molecular weight of 479.59 g/mol. Its IUPAC name is 1-[2-[5-[4-[carbamimidoyl(methyl)amino]phenyl]-1H-indol-3-yl]-3H-benzimidazol-5-yl]-1,3,3-trimethylguanidine.
| Compound Name | 1-[2-[5-[4-[carbamimidoyl(methyl)amino]phenyl]-1H-indol-3-yl]-3H-benzimidazol-5-yl]-1,3,3-trimethylguanidine |
|---|---|
| PubChem CID | 156529017 |
| Molecular Formula | C27H29N9 |
| Molecular Weight | 479.59 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | 1-[2-[5-[4-[carbamimidoyl(methyl)amino]phenyl]-1H-indol-3-yl]-3H-benzimidazol-5-yl]-1,3,3-trimethylguanidine |
| SMILES | [H]/N=C(\N)N(C)c1ccc(-c2ccc3[nH]cc(-c4nc5ccc(N(C)/C(=N/[H])N(C)C)cc5[nH]4)c3c2)cc1 |
| InChI | InChI=1S/C27H29N9/c1-34(2)27(30)36(4)19-10-12-23-24(14-19)33-25(32-23)21-15-31-22-11-7-17(13-20(21)22)16-5-8-18(9-6-16)35(3)26(28)29/h5-15,30-31H,1-4H3,(H3,28,29)(H,32,33)/b30-27+ |
| InChIKey | OIIPOAJGZKWDJV-KDJFERLWSA-N |
| XLogP | 4.64 |
| TPSA | 127.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|