C25H25N9 — CID 156529102
1-[4-[3-[6-(diaminomethylideneamino)-1H-benzimidazol-2-yl]-1H-indol-5-yl]phenyl]-1,2-dimethylguanidine (PubChem CID 156529102) has the molecular formula C25H25N9 and a molecular weight of 451.54 g/mol. Its IUPAC name is 1-[4-[3-[6-(diaminomethylideneamino)-1H-benzimidazol-2-yl]-1H-indol-5-yl]phenyl]-1,2-dimethylguanidine.
| Compound Name | 1-[4-[3-[6-(diaminomethylideneamino)-1H-benzimidazol-2-yl]-1H-indol-5-yl]phenyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 156529102 |
| Molecular Formula | C25H25N9 |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 1-[4-[3-[6-(diaminomethylideneamino)-1H-benzimidazol-2-yl]-1H-indol-5-yl]phenyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(\N)N(C)c1ccc(-c2ccc3[nH]cc(-c4nc5ccc(N=C(N)N)cc5[nH]4)c3c2)cc1 |
| InChI | InChI=1S/C25H25N9/c1-29-25(28)34(2)17-7-3-14(4-8-17)15-5-9-20-18(11-15)19(13-30-20)23-32-21-10-6-16(31-24(26)27)12-22(21)33-23/h3-13,30H,1-2H3,(H2,28,29)(H,32,33)(H4,26,27,31) |
| InChIKey | GAIFDCVATLYHJG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 150.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|