C18H25Cl2NO4S — CID 156531180
tert-butyl (3S)-2-[(3,4-dichlorophenyl)sulfinylcarbamoyl]-2,3-dimethylpentanoate (PubChem CID 156531180) has the molecular formula C18H25Cl2NO4S and a molecular weight of 422.37 g/mol. Its IUPAC name is tert-butyl (3S)-2-[(3,4-dichlorophenyl)sulfinylcarbamoyl]-2,3-dimethylpentanoate.
| Compound Name | tert-butyl (3S)-2-[(3,4-dichlorophenyl)sulfinylcarbamoyl]-2,3-dimethylpentanoate |
|---|---|
| PubChem CID | 156531180 |
| Molecular Formula | C18H25Cl2NO4S |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | tert-butyl (3S)-2-[(3,4-dichlorophenyl)sulfinylcarbamoyl]-2,3-dimethylpentanoate |
| SMILES | CC[C@H](C)C(C)(C(=O)NS(=O)c1ccc(Cl)c(Cl)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H25Cl2NO4S/c1-7-11(2)18(6,16(23)25-17(3,4)5)15(22)21-26(24)12-8-9-13(19)14(20)10-12/h8-11H,7H2,1-6H3,(H,21,22)/t11-,18?,26?/m0/s1 |
| InChIKey | ICDUFZXKDBZPPB-XNMSFDKKSA-N |
| XLogP | 4.53 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|