C19H29NO4S — CID 156530813
tert-butyl 2,4-dimethyl-2-[(4-methylphenyl)sulfinylcarbamoyl]pentanoate (PubChem CID 156530813) has the molecular formula C19H29NO4S and a molecular weight of 367.51 g/mol. Its IUPAC name is tert-butyl 2,4-dimethyl-2-[(4-methylphenyl)sulfinylcarbamoyl]pentanoate.
| Compound Name | tert-butyl 2,4-dimethyl-2-[(4-methylphenyl)sulfinylcarbamoyl]pentanoate |
|---|---|
| PubChem CID | 156530813 |
| Molecular Formula | C19H29NO4S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | tert-butyl 2,4-dimethyl-2-[(4-methylphenyl)sulfinylcarbamoyl]pentanoate |
| SMILES | Cc1ccc(S(=O)NC(=O)C(C)(CC(C)C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H29NO4S/c1-13(2)12-19(7,17(22)24-18(4,5)6)16(21)20-25(23)15-10-8-14(3)9-11-15/h8-11,13H,12H2,1-7H3,(H,20,21) |
| InChIKey | YXOPYKPTUOEMQL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|