C21H26O7S — CID 177391533
dimethyl 2-[(E)-2-(4-methylphenyl)sulfinyl-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]cyclopropane-1,1-dicarboxylate (PubChem CID 177391533) has the molecular formula C21H26O7S and a molecular weight of 422.50 g/mol. Its IUPAC name is dimethyl 2-[(E)-2-(4-methylphenyl)sulfinyl-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]cyclopropane-1,1-dicarboxylate.
| Compound Name | dimethyl 2-[(E)-2-(4-methylphenyl)sulfinyl-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 177391533 |
| Molecular Formula | C21H26O7S |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | dimethyl 2-[(E)-2-(4-methylphenyl)sulfinyl-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]cyclopropane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC1/C=C(\C(=O)OC(C)(C)C)S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H26O7S/c1-13-7-9-15(10-8-13)29(25)16(17(22)28-20(2,3)4)11-14-12-21(14,18(23)26-5)19(24)27-6/h7-11,14H,12H2,1-6H3/b16-11+ |
| InChIKey | AFNXROTUULIHRE-LFIBNONCSA-N |
| XLogP | 2.68 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|