C26H31F3N4O — CID 156537278
1,1-difluoro-1-[2-fluoro-3-[2-[(2,6,8,8-tetramethyl-7H-pyrrolo[2,3-g]quinazolin-4-yl)amino]ethyl]phenyl]-2-methylpropan-2-ol (PubChem CID 156537278) has the molecular formula C26H31F3N4O and a molecular weight of 472.56 g/mol. Its IUPAC name is 1,1-difluoro-1-[2-fluoro-3-[2-[(2,6,8,8-tetramethyl-7H-pyrrolo[2,3-g]quinazolin-4-yl)amino]ethyl]phenyl]-2-methylpropan-2-ol.
| Compound Name | 1,1-difluoro-1-[2-fluoro-3-[2-[(2,6,8,8-tetramethyl-7H-pyrrolo[2,3-g]quinazolin-4-yl)amino]ethyl]phenyl]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 156537278 |
| Molecular Formula | C26H31F3N4O |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 1,1-difluoro-1-[2-fluoro-3-[2-[(2,6,8,8-tetramethyl-7H-pyrrolo[2,3-g]quinazolin-4-yl)amino]ethyl]phenyl]-2-methylpropan-2-ol |
| SMILES | Cc1nc(NCCc2cccc(C(F)(F)C(C)(C)O)c2F)c2cc3c(cc2n1)C(C)(C)CN3C |
| InChI | InChI=1S/C26H31F3N4O/c1-15-31-20-13-19-21(33(6)14-24(19,2)3)12-17(20)23(32-15)30-11-10-16-8-7-9-18(22(16)27)26(28,29)25(4,5)34/h7-9,12-13,34H,10-11,14H2,1-6H3,(H,30,31,32) |
| InChIKey | FOPBFDHFBCLDFR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |