C24H30N2O4 — CID 156540049
2-amino-N-[4-[2-[3-ethoxy-5-hydroxy-2-(3-methylbut-2-enyl)phenyl]ethenyl]-2-methoxyphenyl]acetamide (PubChem CID 156540049) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 2-amino-N-[4-[2-[3-ethoxy-5-hydroxy-2-(3-methylbut-2-enyl)phenyl]ethenyl]-2-methoxyphenyl]acetamide.
| Compound Name | 2-amino-N-[4-[2-[3-ethoxy-5-hydroxy-2-(3-methylbut-2-enyl)phenyl]ethenyl]-2-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 156540049 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 2-amino-N-[4-[2-[3-ethoxy-5-hydroxy-2-(3-methylbut-2-enyl)phenyl]ethenyl]-2-methoxyphenyl]acetamide |
| SMILES | CCOc1cc(O)cc(C=Cc2ccc(NC(=O)CN)c(OC)c2)c1CC=C(C)C |
| InChI | InChI=1S/C24H30N2O4/c1-5-30-22-14-19(27)13-18(20(22)10-6-16(2)3)9-7-17-8-11-21(23(12-17)29-4)26-24(28)15-25/h6-9,11-14,27H,5,10,15,25H2,1-4H3,(H,26,28) |
| InChIKey | KCQSTWRNHRVMNR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|