About 1-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]cyclopropane-1-carboxylic acid
1-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]cyclopropane-1-carboxylic acid (PubChem CID 156546720) has the molecular formula C13H13NO3
and a molecular weight of 231.25 g/mol. Its IUPAC name is 1-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]cyclopropane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]cyclopropane-1-carboxylic acid |
| PubChem CID | 156546720 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 1-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2ccc3c(c2)CC/C3=N\O)CC1 |
| InChI | InChI=1S/C13H13NO3/c15-12(16)13(5-6-13)9-2-3-10-8(7-9)1-4-11(10)14-17/h2-3,7,17H,1,4-6H2,(H,15,16)/b14-11+ |
| InChIKey | PQBPJGGNJXMOJO-SDNWHVSQSA-N |
| XLogP | 1.93 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]cyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]cyclopropane-1-carboxylic acid?
The IUPAC name of 1-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]cyclopropane-1-carboxylic acid (CID 156546720) is 1-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]cyclopropane-1-carboxylic acid.
What is the SMILES notation for 1-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]cyclopropane-1-carboxylic acid?
The canonical SMILES for 1-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]cyclopropane-1-carboxylic acid is O=C(O)C1(c2ccc3c(c2)CC/C3=N\O)CC1.
What is the InChIKey of 1-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]cyclopropane-1-carboxylic acid?
The InChIKey is PQBPJGGNJXMOJO-SDNWHVSQSA-N. The full InChI is InChI=1S/C13H13NO3/c15-12(16)13(5-6-13)9-2-3-10-8(7-9)1-4-11(10)14-17/h2-3,7,17H,1,4-6H2,(H,15,16)/b14-11+.
What are the key properties of 1-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]cyclopropane-1-carboxylic acid?
1-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]cyclopropane-1-carboxylic acid has a molecular weight of 231.25 g/mol, XLogP of 1.93, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]cyclopropane-1-carboxylic acid is sourced from PubChem (CID 156546720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).