C13H13NO3 — CID 156546720
1-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]cyclopropane-1-carboxylic acid (PubChem CID 156546720) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 1-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 156546720 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 1-[(1E)-1-hydroxyimino-2,3-dihydroinden-5-yl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2ccc3c(c2)CC/C3=N\O)CC1 |
| InChI | InChI=1S/C13H13NO3/c15-12(16)13(5-6-13)9-2-3-10-8(7-9)1-4-11(10)14-17/h2-3,7,17H,1,4-6H2,(H,15,16)/b14-11+ |
| InChIKey | PQBPJGGNJXMOJO-SDNWHVSQSA-N |
| XLogP | 1.93 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|