C22H32F6N8O2 — CID 156566022
4-(4-nitropyrazol-1-yl)-1-(3,3,3-trifluoropropyl)piperidine;1-[1-(3,3,3-trifluoropropyl)piperidin-4-yl]pyrazol-4-amine (PubChem CID 156566022) has the molecular formula C22H32F6N8O2 and a molecular weight of 554.54 g/mol. Its IUPAC name is 4-(4-nitropyrazol-1-yl)-1-(3,3,3-trifluoropropyl)piperidine;1-[1-(3,3,3-trifluoropropyl)piperidin-4-yl]pyrazol-4-amine.
| Compound Name | 4-(4-nitropyrazol-1-yl)-1-(3,3,3-trifluoropropyl)piperidine;1-[1-(3,3,3-trifluoropropyl)piperidin-4-yl]pyrazol-4-amine |
|---|---|
| PubChem CID | 156566022 |
| Molecular Formula | C22H32F6N8O2 |
| Molecular Weight | 554.54 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | 4-(4-nitropyrazol-1-yl)-1-(3,3,3-trifluoropropyl)piperidine;1-[1-(3,3,3-trifluoropropyl)piperidin-4-yl]pyrazol-4-amine |
| SMILES | Nc1cnn(C2CCN(CCC(F)(F)F)CC2)c1.O=[N+]([O-])c1cnn(C2CCN(CCC(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C11H15F3N4O2.C11H17F3N4/c12-11(13,14)3-6-16-4-1-9(2-5-16)17-8-10(7-15-17)18(19)20;12-11(13,14)3-6-17-4-1-10(2-5-17)18-8-9(15)7-16-18/h7-9H,1-6H2;7-8,10H,1-6,15H2 |
| InChIKey | YQPIVUCDADIPLI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 111.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|