C19H16N2O3S — CID 156576013
3-methyl-4-[(2-methyl-1,1-dioxothieno[2,3-g]quinolin-8-yl)amino]phenol (PubChem CID 156576013) has the molecular formula C19H16N2O3S and a molecular weight of 352.42 g/mol. Its IUPAC name is 3-methyl-4-[(2-methyl-1,1-dioxothieno[2,3-g]quinolin-8-yl)amino]phenol.
| Compound Name | 3-methyl-4-[(2-methyl-1,1-dioxothieno[2,3-g]quinolin-8-yl)amino]phenol |
|---|---|
| PubChem CID | 156576013 |
| Molecular Formula | C19H16N2O3S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 3-methyl-4-[(2-methyl-1,1-dioxothieno[2,3-g]quinolin-8-yl)amino]phenol |
| SMILES | CC1=Cc2cc3nccc(Nc4ccc(O)cc4C)c3cc2S1(=O)=O |
| InChI | InChI=1S/C19H16N2O3S/c1-11-7-14(22)3-4-16(11)21-17-5-6-20-18-9-13-8-12(2)25(23,24)19(13)10-15(17)18/h3-10,22H,1-2H3,(H,20,21) |
| InChIKey | WMXFSLUTEUIBJO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|