C23H34O6 — CID 156577589
(E)-3-[3-methoxy-4-[(2,4,4-trimethyl-2-propan-2-ylhexanoyl)oxymethoxy]phenyl]prop-2-enoic acid (PubChem CID 156577589) has the molecular formula C23H34O6 and a molecular weight of 406.52 g/mol. Its IUPAC name is (E)-3-[3-methoxy-4-[(2,4,4-trimethyl-2-propan-2-ylhexanoyl)oxymethoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-methoxy-4-[(2,4,4-trimethyl-2-propan-2-ylhexanoyl)oxymethoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 156577589 |
| Molecular Formula | C23H34O6 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | (E)-3-[3-methoxy-4-[(2,4,4-trimethyl-2-propan-2-ylhexanoyl)oxymethoxy]phenyl]prop-2-enoic acid |
| SMILES | CCC(C)(C)CC(C)(C(=O)OCOc1ccc(/C=C/C(=O)O)cc1OC)C(C)C |
| InChI | InChI=1S/C23H34O6/c1-8-22(4,5)14-23(6,16(2)3)21(26)29-15-28-18-11-9-17(10-12-20(24)25)13-19(18)27-7/h9-13,16H,8,14-15H2,1-7H3,(H,24,25)/b12-10+ |
| InChIKey | MEWCWKYXTRYNBY-ZRDIBKRKSA-N |
| XLogP | 5.16 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|