C23H23Cl2N5O2S — CID 156577912
2-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]phenyl]-N-[4-[(dimethyl-λ4-sulfanylidene)amino]phenyl]-2-iminoacetamide (PubChem CID 156577912) has the molecular formula C23H23Cl2N5O2S and a molecular weight of 504.44 g/mol. Its IUPAC name is 2-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]phenyl]-N-[4-[(dimethyl-λ4-sulfanylidene)amino]phenyl]-2-iminoacetamide.
| Compound Name | 2-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]phenyl]-N-[4-[(dimethyl-λ4-sulfanylidene)amino]phenyl]-2-iminoacetamide |
|---|---|
| PubChem CID | 156577912 |
| Molecular Formula | C23H23Cl2N5O2S |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | 2-[2-amino-5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]phenyl]-N-[4-[(dimethyl-λ4-sulfanylidene)amino]phenyl]-2-iminoacetamide |
| SMILES | [H]/N=C(\C(=O)Nc1ccc(N=S(C)C)cc1)c1cc(OC(C)c2c(Cl)cncc2Cl)ccc1N |
| InChI | InChI=1S/C23H23Cl2N5O2S/c1-13(21-18(24)11-28-12-19(21)25)32-16-8-9-20(26)17(10-16)22(27)23(31)29-14-4-6-15(7-5-14)30-33(2)3/h4-13,27H,26H2,1-3H3,(H,29,31)/b27-22- |
| InChIKey | ZIFCLWPCQJWYKA-QYQHSDTDSA-N |
| XLogP | 5.81 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|