C24H32FN3O5S — CID 156579697
6-[(2R,3R,4R,5R)-3-fluoro-4-(oxan-2-yloxy)-5-(oxan-2-yloxymethyl)oxolan-2-yl]-11-thia-6,7,10-triazatricyclo[6.4.1.04,13]trideca-1(13),4,7,9-tetraene (PubChem CID 156579697) has the molecular formula C24H32FN3O5S and a molecular weight of 493.60 g/mol. Its IUPAC name is 6-[(2R,3R,4R,5R)-3-fluoro-4-(oxan-2-yloxy)-5-(oxan-2-yloxymethyl)oxolan-2-yl]-11-thia-6,7,10-triazatricyclo[6.4.1.04,13]trideca-1(13),4,7,9-tetraene.
| Compound Name | 6-[(2R,3R,4R,5R)-3-fluoro-4-(oxan-2-yloxy)-5-(oxan-2-yloxymethyl)oxolan-2-yl]-11-thia-6,7,10-triazatricyclo[6.4.1.04,13]trideca-1(13),4,7,9-tetraene |
|---|---|
| PubChem CID | 156579697 |
| Molecular Formula | C24H32FN3O5S |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 6-[(2R,3R,4R,5R)-3-fluoro-4-(oxan-2-yloxy)-5-(oxan-2-yloxymethyl)oxolan-2-yl]-11-thia-6,7,10-triazatricyclo[6.4.1.04,13]trideca-1(13),4,7,9-tetraene |
| SMILES | F[C@@H]1[C@H](OC2CCCCO2)[C@@H](COC2CCCCO2)O[C@H]1N1C=C2CCC3=C2C(=N1)C=NSC3 |
| InChI | InChI=1S/C24H32FN3O5S/c25-22-23(33-20-6-2-4-10-30-20)18(13-31-19-5-1-3-9-29-19)32-24(22)28-12-15-7-8-16-14-34-26-11-17(27-28)21(15)16/h11-12,18-20,22-24H,1-10,13-14H2/t18-,19?,20?,22-,23-,24-/m1/s1 |
| InChIKey | AFLUYNOYMZOKFB-WEYDDZAWSA-N |
| XLogP | 3.88 |
| TPSA | 74.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|