C29H35N2O11P — CID 70423813
[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-(oxan-2-yloxy)-2-(oxan-2-yloxymethyl)oxolan-3-yl] naphthalen-1-yl hydrogen phosphate (PubChem CID 70423813) has the molecular formula C29H35N2O11P and a molecular weight of 618.58 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-(oxan-2-yloxy)-2-(oxan-2-yloxymethyl)oxolan-3-yl] naphthalen-1-yl hydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-(oxan-2-yloxy)-2-(oxan-2-yloxymethyl)oxolan-3-yl] naphthalen-1-yl hydrogen phosphate |
|---|---|
| PubChem CID | 70423813 |
| Molecular Formula | C29H35N2O11P |
| Molecular Weight | 618.58 g/mol |
| Exact Mass | 618.20 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-(oxan-2-yloxy)-2-(oxan-2-yloxymethyl)oxolan-3-yl] naphthalen-1-yl hydrogen phosphate |
| SMILES | O=c1ccn([C@@H]2O[C@H](COC3CCCCO3)[C@@H](OP(=O)(O)Oc3cccc4ccccc34)[C@H]2OC2CCCCO2)c(=O)[nH]1 |
| InChI | InChI=1S/C29H35N2O11P/c32-23-14-15-31(29(33)30-23)28-27(40-25-13-4-6-17-37-25)26(22(39-28)18-38-24-12-3-5-16-36-24)42-43(34,35)41-21-11-7-9-19-8-1-2-10-20(19)21/h1-2,7-11,14-15,22,24-28H,3-6,12-13,16-18H2,(H,34,35)(H,30,32,33)/t22-,24?,25?,26-,27-,28-/m1/s1 |
| InChIKey | KGBRCTVZMKFMHX-PMYBWLJGSA-N |
| XLogP | 3.61 |
| TPSA | 156.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.58 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|