C23H37N2O11P — CID 10626441
[(2R,3R,4R,5R)-3-diethoxyphosphoryloxy-5-(2,4-dioxopyrimidin-1-yl)-4-(oxan-2-yloxy)oxolan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 10626441) has the molecular formula C23H37N2O11P and a molecular weight of 548.53 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3-diethoxyphosphoryloxy-5-(2,4-dioxopyrimidin-1-yl)-4-(oxan-2-yloxy)oxolan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4R,5R)-3-diethoxyphosphoryloxy-5-(2,4-dioxopyrimidin-1-yl)-4-(oxan-2-yloxy)oxolan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10626441 |
| Molecular Formula | C23H37N2O11P |
| Molecular Weight | 548.53 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | [(2R,3R,4R,5R)-3-diethoxyphosphoryloxy-5-(2,4-dioxopyrimidin-1-yl)-4-(oxan-2-yloxy)oxolan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CCOP(=O)(OCC)O[C@H]1[C@@H](OC2CCCCO2)[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]1COC(=O)C(C)(C)C |
| InChI | InChI=1S/C23H37N2O11P/c1-6-32-37(29,33-7-2)36-18-15(14-31-21(27)23(3,4)5)34-20(25-12-11-16(26)24-22(25)28)19(18)35-17-10-8-9-13-30-17/h11-12,15,17-20H,6-10,13-14H2,1-5H3,(H,24,26,28)/t15-,17?,18-,19-,20-/m1/s1 |
| InChIKey | AOUVCFVWOJBGOL-AVALQCPYSA-N |
| XLogP | 2.50 |
| TPSA | 153.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.53 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|