C24H28ClN2O13P — CID 69476969
[(2R,3R,4S,5R)-3-[(2-chlorophenoxy)-hydroxyphosphoryl]oxy-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-(oxolan-2-yloxy)oxolan-2-yl]methyl 4-oxopentanoate (PubChem CID 69476969) has the molecular formula C24H28ClN2O13P and a molecular weight of 618.92 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3-[(2-chlorophenoxy)-hydroxyphosphoryl]oxy-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-(oxolan-2-yloxy)oxolan-2-yl]methyl 4-oxopentanoate.
| Compound Name | [(2R,3R,4S,5R)-3-[(2-chlorophenoxy)-hydroxyphosphoryl]oxy-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-(oxolan-2-yloxy)oxolan-2-yl]methyl 4-oxopentanoate |
|---|---|
| PubChem CID | 69476969 |
| Molecular Formula | C24H28ClN2O13P |
| Molecular Weight | 618.92 g/mol |
| Exact Mass | 618.10 |
| IUPAC Name | [(2R,3R,4S,5R)-3-[(2-chlorophenoxy)-hydroxyphosphoryl]oxy-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-(oxolan-2-yloxy)oxolan-2-yl]methyl 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](OC2CCCO2)[C@]1(O)OP(=O)(O)Oc1ccccc1Cl |
| InChI | InChI=1S/C24H28ClN2O13P/c1-14(28)8-9-19(30)36-13-17-24(32,40-41(33,34)39-16-6-3-2-5-15(16)25)21(38-20-7-4-12-35-20)22(37-17)27-11-10-18(29)26-23(27)31/h2-3,5-6,10-11,17,20-22,32H,4,7-9,12-13H2,1H3,(H,33,34)(H,26,29,31)/t17-,20?,21+,22-,24-/m1/s1 |
| InChIKey | FOYHXRACOSHVNF-VZZZQXOLSA-N |
| XLogP | 1.41 |
| TPSA | 201.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.92 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|