C20H30O3 — CID 156582053
(1S,9S,10R,12R,14S,15S)-14-hydroxy-4,9,15,16,16-pentamethyl-6-oxatetracyclo[10.3.1.01,10.05,9]hexadec-4-en-7-one (PubChem CID 156582053) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1S,9S,10R,12R,14S,15S)-14-hydroxy-4,9,15,16,16-pentamethyl-6-oxatetracyclo[10.3.1.01,10.05,9]hexadec-4-en-7-one.
| Compound Name | (1S,9S,10R,12R,14S,15S)-14-hydroxy-4,9,15,16,16-pentamethyl-6-oxatetracyclo[10.3.1.01,10.05,9]hexadec-4-en-7-one |
|---|---|
| PubChem CID | 156582053 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1S,9S,10R,12R,14S,15S)-14-hydroxy-4,9,15,16,16-pentamethyl-6-oxatetracyclo[10.3.1.01,10.05,9]hexadec-4-en-7-one |
| SMILES | CC1=C2OC(=O)C[C@@]2(C)[C@@H]2C[C@@H]3C[C@H](O)[C@@H](C)[C@@]2(CC1)C3(C)C |
| InChI | InChI=1S/C20H30O3/c1-11-6-7-20-12(2)14(21)8-13(18(20,3)4)9-15(20)19(5)10-16(22)23-17(11)19/h12-15,21H,6-10H2,1-5H3/t12-,13+,14+,15+,19+,20-/m1/s1 |
| InChIKey | LFIYBYDTAAVRQW-XWZQZKPHSA-N |
| XLogP | 4.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |