C20H32O2 — CID 156582058
(1S,6R,8S,9S,11R,13S,14S)-4,8,14,15,15-pentamethyltetracyclo[9.3.1.01,9.05,8]pentadec-4-ene-6,13-diol (PubChem CID 156582058) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1S,6R,8S,9S,11R,13S,14S)-4,8,14,15,15-pentamethyltetracyclo[9.3.1.01,9.05,8]pentadec-4-ene-6,13-diol.
| Compound Name | (1S,6R,8S,9S,11R,13S,14S)-4,8,14,15,15-pentamethyltetracyclo[9.3.1.01,9.05,8]pentadec-4-ene-6,13-diol |
|---|---|
| PubChem CID | 156582058 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1S,6R,8S,9S,11R,13S,14S)-4,8,14,15,15-pentamethyltetracyclo[9.3.1.01,9.05,8]pentadec-4-ene-6,13-diol |
| SMILES | CC1=C2[C@H](O)C[C@@]2(C)[C@@H]2C[C@@H]3C[C@H](O)[C@@H](C)[C@@]2(CC1)C3(C)C |
| InChI | InChI=1S/C20H32O2/c1-11-6-7-20-12(2)14(21)8-13(18(20,3)4)9-16(20)19(5)10-15(22)17(11)19/h12-16,21-22H,6-10H2,1-5H3/t12-,13+,14+,15-,16+,19+,20-/m1/s1 |
| InChIKey | CPAOSCNVALWAGK-YKVXWXDXSA-N |
| XLogP | 3.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|